C13H9Br2F2N — CID 114023013
(3,5-dibromophenyl)-(2,3-difluorophenyl)methanamine (PubChem CID 114023013) has the molecular formula C13H9Br2F2N and a molecular weight of 377.03 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(2,3-difluorophenyl)methanamine.
| Compound Name | (3,5-dibromophenyl)-(2,3-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 114023013 |
| Molecular Formula | C13H9Br2F2N |
| Molecular Weight | 377.03 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | (3,5-dibromophenyl)-(2,3-difluorophenyl)methanamine |
| SMILES | NC(c1cc(Br)cc(Br)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H9Br2F2N/c14-8-4-7(5-9(15)6-8)13(18)10-2-1-3-11(16)12(10)17/h1-6,13H,18H2 |
| InChIKey | DBQVZDXFCFPLBJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.03 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |