C10H11F2NO3 — CID 171254903
3-[(1R)-1-amino-2,2-difluoroethyl]-4-hydroxy-5-methylbenzoic acid (PubChem CID 171254903) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2-difluoroethyl]-4-hydroxy-5-methylbenzoic acid.
| Compound Name | 3-[(1R)-1-amino-2,2-difluoroethyl]-4-hydroxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 171254903 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-[(1R)-1-amino-2,2-difluoroethyl]-4-hydroxy-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc([C@@H](N)C(F)F)c1O |
| InChI | InChI=1S/C10H11F2NO3/c1-4-2-5(10(15)16)3-6(8(4)14)7(13)9(11)12/h2-3,7,9,14H,13H2,1H3,(H,15,16)/t7-/m1/s1 |
| InChIKey | PYTUSUSOWOSPFW-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|