C9H10FNO3 — CID 55274678
3-[(1R)-1-aminoethyl]-5-fluoro-4-hydroxybenzoic acid (PubChem CID 55274678) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 3-[(1R)-1-aminoethyl]-5-fluoro-4-hydroxybenzoic acid.
| Compound Name | 3-[(1R)-1-aminoethyl]-5-fluoro-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 55274678 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-[(1R)-1-aminoethyl]-5-fluoro-4-hydroxybenzoic acid |
| SMILES | C[C@@H](N)c1cc(C(=O)O)cc(F)c1O |
| InChI | InChI=1S/C9H10FNO3/c1-4(11)6-2-5(9(13)14)3-7(10)8(6)12/h2-4,12H,11H2,1H3,(H,13,14)/t4-/m1/s1 |
| InChIKey | YCMNFENGCJMUIX-SCSAIBSYSA-N |
| XLogP | 1.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|