C12H15FO3S2 — CID 155701154
3-[bis(ethylsulfanyl)methyl]-5-fluoro-4-hydroxybenzoic acid (PubChem CID 155701154) has the molecular formula C12H15FO3S2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-[bis(ethylsulfanyl)methyl]-5-fluoro-4-hydroxybenzoic acid.
| Compound Name | 3-[bis(ethylsulfanyl)methyl]-5-fluoro-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 155701154 |
| Molecular Formula | C12H15FO3S2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-[bis(ethylsulfanyl)methyl]-5-fluoro-4-hydroxybenzoic acid |
| SMILES | CCSC(SCC)c1cc(C(=O)O)cc(F)c1O |
| InChI | InChI=1S/C12H15FO3S2/c1-3-17-12(18-4-2)8-5-7(11(15)16)6-9(13)10(8)14/h5-6,12,14H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | ZACUIMPRORJECK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|