C12H16FNO4 — CID 171259482
3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-5-fluoro-4-hydroxybenzoic acid (PubChem CID 171259482) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-5-fluoro-4-hydroxybenzoic acid.
| Compound Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-5-fluoro-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171259482 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-5-fluoro-4-hydroxybenzoic acid |
| SMILES | CC(C)(CO)[C@@H](N)c1cc(C(=O)O)cc(F)c1O |
| InChI | InChI=1S/C12H16FNO4/c1-12(2,5-15)10(14)7-3-6(11(17)18)4-8(13)9(7)16/h3-4,10,15-16H,5,14H2,1-2H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | VLDVPXDYAHPWOA-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|