3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid

C9H11FN2O3 — CID 66516774

IUPAC3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid
SMILESNC[C@H](N)c1cc(C(=O)O)cc(F)c1O
InChIInChI=1S/C9H11FN2O3/c10-6-2-4(9(14)15)1-5(8(6)13)7(12)3-11/h1-2,7,13H,3,11-12H2,(H,14,15)/t7-/m0/s1
InChIKeyDXARHVDRLXARAD-ZETCQYMHSA-N
MW214.20 g/mol
LogP0.19
Rot. Bonds3

About 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid

3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid (PubChem CID 66516774) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid.

Molecular Properties

Compound Name3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid
PubChem CID66516774
Molecular FormulaC9H11FN2O3
Molecular Weight214.20 g/mol
Exact Mass214.08
IUPAC Name3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid
SMILESNC[C@H](N)c1cc(C(=O)O)cc(F)c1O
InChIInChI=1S/C9H11FN2O3/c10-6-2-4(9(14)15)1-5(8(6)13)7(12)3-11/h1-2,7,13H,3,11-12H2,(H,14,15)/t7-/m0/s1
InChIKeyDXARHVDRLXARAD-ZETCQYMHSA-N
XLogP0.19
TPSA109.57 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.20
LogP ≤ 50.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid?
The IUPAC name of 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid (CID 66516774) is 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid.
What is the SMILES notation for 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid?
The canonical SMILES for 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid is NC[C@H](N)c1cc(C(=O)O)cc(F)c1O.
What is the InChIKey of 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid?
The InChIKey is DXARHVDRLXARAD-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H11FN2O3/c10-6-2-4(9(14)15)1-5(8(6)13)7(12)3-11/h1-2,7,13H,3,11-12H2,(H,14,15)/t7-/m0/s1.
What are the key properties of 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid?
3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid has a molecular weight of 214.20 g/mol, XLogP of 0.19, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid is sourced from PubChem (CID 66516774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).