C9H11FN2O3 — CID 66516774
3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid (PubChem CID 66516774) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid.
| Compound Name | 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66516774 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-[(1R)-1,2-diaminoethyl]-5-fluoro-4-hydroxybenzoic acid |
| SMILES | NC[C@H](N)c1cc(C(=O)O)cc(F)c1O |
| InChI | InChI=1S/C9H11FN2O3/c10-6-2-4(9(14)15)1-5(8(6)13)7(12)3-11/h1-2,7,13H,3,11-12H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | DXARHVDRLXARAD-ZETCQYMHSA-N |
| XLogP | 0.19 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|