C9H10ClF2NO3 — CID 171256114
3-[(1R)-1-amino-2-fluoroethyl]-5-fluoro-4-hydroxybenzoic acid;hydrochloride (PubChem CID 171256114) has the molecular formula C9H10ClF2NO3 and a molecular weight of 253.63 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2-fluoroethyl]-5-fluoro-4-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-2-fluoroethyl]-5-fluoro-4-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171256114 |
| Molecular Formula | C9H10ClF2NO3 |
| Molecular Weight | 253.63 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 3-[(1R)-1-amino-2-fluoroethyl]-5-fluoro-4-hydroxybenzoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CF)c1cc(C(=O)O)cc(F)c1O |
| InChI | InChI=1S/C9H9F2NO3.ClH/c10-3-7(12)5-1-4(9(14)15)2-6(11)8(5)13;/h1-2,7,13H,3,12H2,(H,14,15);1H/t7-;/m0./s1 |
| InChIKey | IIFFXQVLAGJBPI-FJXQXJEOSA-N |
| XLogP | 1.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|