C12H17BrClNO3 — CID 171254818
3-[(1S)-1-amino-3-methylbutyl]-5-bromo-4-hydroxybenzoic acid;hydrochloride (PubChem CID 171254818) has the molecular formula C12H17BrClNO3 and a molecular weight of 338.63 g/mol. Its IUPAC name is 3-[(1S)-1-amino-3-methylbutyl]-5-bromo-4-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[(1S)-1-amino-3-methylbutyl]-5-bromo-4-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171254818 |
| Molecular Formula | C12H17BrClNO3 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-[(1S)-1-amino-3-methylbutyl]-5-bromo-4-hydroxybenzoic acid;hydrochloride |
| SMILES | CC(C)C[C@H](N)c1cc(C(=O)O)cc(Br)c1O.Cl |
| InChI | InChI=1S/C12H16BrNO3.ClH/c1-6(2)3-10(14)8-4-7(12(16)17)5-9(13)11(8)15;/h4-6,10,15H,3,14H2,1-2H3,(H,16,17);1H/t10-;/m0./s1 |
| InChIKey | MRIAFNHXDLHINV-PPHPATTJSA-N |
| XLogP | 3.32 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|