C8H10FN3O3 — CID 66517594
2-[(1R)-1,2-diaminoethyl]-6-fluoro-4-nitrophenol (PubChem CID 66517594) has the molecular formula C8H10FN3O3 and a molecular weight of 215.18 g/mol. Its IUPAC name is 2-[(1R)-1,2-diaminoethyl]-6-fluoro-4-nitrophenol.
| Compound Name | 2-[(1R)-1,2-diaminoethyl]-6-fluoro-4-nitrophenol |
|---|---|
| PubChem CID | 66517594 |
| Molecular Formula | C8H10FN3O3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-[(1R)-1,2-diaminoethyl]-6-fluoro-4-nitrophenol |
| SMILES | NC[C@H](N)c1cc([N+](=O)[O-])cc(F)c1O |
| InChI | InChI=1S/C8H10FN3O3/c9-6-2-4(12(14)15)1-5(8(6)13)7(11)3-10/h1-2,7,13H,3,10-11H2/t7-/m0/s1 |
| InChIKey | RXLBJFFXQNHBOE-ZETCQYMHSA-N |
| XLogP | 0.40 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|