C11H12ClF3N2O5 — CID 171258022
ethyl (3S)-3-amino-2,2-difluoro-3-(3-fluoro-2-hydroxy-5-nitrophenyl)propanoate;hydrochloride (PubChem CID 171258022) has the molecular formula C11H12ClF3N2O5 and a molecular weight of 344.67 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,2-difluoro-3-(3-fluoro-2-hydroxy-5-nitrophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2,2-difluoro-3-(3-fluoro-2-hydroxy-5-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171258022 |
| Molecular Formula | C11H12ClF3N2O5 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl (3S)-3-amino-2,2-difluoro-3-(3-fluoro-2-hydroxy-5-nitrophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cc([N+](=O)[O-])cc(F)c1O.Cl |
| InChI | InChI=1S/C11H11F3N2O5.ClH/c1-2-21-10(18)11(13,14)9(15)6-3-5(16(19)20)4-7(12)8(6)17;/h3-4,9,17H,2,15H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | RUAUGKGKGDMGLJ-FVGYRXGTSA-N |
| XLogP | 2.06 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|