C13H20ClNO4 — CID 171258274
3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride (PubChem CID 171258274) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171258274 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride |
| SMILES | Cc1cc(C(=O)O)cc([C@H](N)C(C)(C)CO)c1O.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-7-4-8(12(17)18)5-9(10(7)16)11(14)13(2,3)6-15;/h4-5,11,15-16H,6,14H2,1-3H3,(H,17,18);1H/t11-;/m0./s1 |
| InChIKey | SDBLIFYADPLPOA-MERQFXBCSA-N |
| XLogP | 1.84 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|