C8H9ClFNO2 — CID 84778822
4-(1-aminoethyl)-2-chloro-6-fluorobenzene-1,3-diol (PubChem CID 84778822) has the molecular formula C8H9ClFNO2 and a molecular weight of 205.62 g/mol. Its IUPAC name is 4-(1-aminoethyl)-2-chloro-6-fluorobenzene-1,3-diol.
| Compound Name | 4-(1-aminoethyl)-2-chloro-6-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84778822 |
| Molecular Formula | C8H9ClFNO2 |
| Molecular Weight | 205.62 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 4-(1-aminoethyl)-2-chloro-6-fluorobenzene-1,3-diol |
| SMILES | CC(N)c1cc(F)c(O)c(Cl)c1O |
| InChI | InChI=1S/C8H9ClFNO2/c1-3(11)4-2-5(10)8(13)6(9)7(4)12/h2-3,12-13H,11H2,1H3 |
| InChIKey | IMDCVDYPQQXXTP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|