C10H13ClFN — CID 84776597
1-(3-chloro-5-fluoro-2,4-dimethylphenyl)ethanamine (PubChem CID 84776597) has the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2,4-dimethylphenyl)ethanamine.
| Compound Name | 1-(3-chloro-5-fluoro-2,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 84776597 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2,4-dimethylphenyl)ethanamine |
| SMILES | Cc1c(F)cc(C(C)N)c(C)c1Cl |
| InChI | InChI=1S/C10H13ClFN/c1-5-8(7(3)13)4-9(12)6(2)10(5)11/h4,7H,13H2,1-3H3 |
| InChIKey | XBXUSQJUCVNERI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |