C10H13ClFNO2 — CID 84796637
1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)ethanamine (PubChem CID 84796637) has the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)ethanamine.
| Compound Name | 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 84796637 |
| Molecular Formula | C10H13ClFNO2 |
| Molecular Weight | 233.67 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1c(F)cc(C(C)N)c(OC)c1Cl |
| InChI | InChI=1S/C10H13ClFNO2/c1-5(13)6-4-7(12)10(15-3)8(11)9(6)14-2/h4-5H,13H2,1-3H3 |
| InChIKey | HERGLRXFXJRVHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |