C11H14ClNO3 — CID 84704040
4-(1-aminoethyl)-6-chloro-2,3-dimethoxybenzaldehyde (PubChem CID 84704040) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(1-aminoethyl)-6-chloro-2,3-dimethoxybenzaldehyde.
| Compound Name | 4-(1-aminoethyl)-6-chloro-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 84704040 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-(1-aminoethyl)-6-chloro-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C(C)N)cc(Cl)c(C=O)c1OC |
| InChI | InChI=1S/C11H14ClNO3/c1-6(13)7-4-9(12)8(5-14)11(16-3)10(7)15-2/h4-6H,13H2,1-3H3 |
| InChIKey | AVIDICZGBLOWBE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|