C12H16ClNO3 — CID 117397772
4-(2-aminopropyl)-5-chloro-2,3-dimethoxybenzaldehyde (PubChem CID 117397772) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 4-(2-aminopropyl)-5-chloro-2,3-dimethoxybenzaldehyde.
| Compound Name | 4-(2-aminopropyl)-5-chloro-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 117397772 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-(2-aminopropyl)-5-chloro-2,3-dimethoxybenzaldehyde |
| SMILES | COc1c(C=O)cc(Cl)c(CC(C)N)c1OC |
| InChI | InChI=1S/C12H16ClNO3/c1-7(14)4-9-10(13)5-8(6-15)11(16-2)12(9)17-3/h5-7H,4,14H2,1-3H3 |
| InChIKey | WNWKINPZRJTEHJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|