C12H16Cl4N2 — CID 170864520
1-[4-(2-aminopropyl)-2,3,5,6-tetrachlorophenyl]propan-2-amine (PubChem CID 170864520) has the molecular formula C12H16Cl4N2 and a molecular weight of 330.09 g/mol. Its IUPAC name is 1-[4-(2-aminopropyl)-2,3,5,6-tetrachlorophenyl]propan-2-amine.
| Compound Name | 1-[4-(2-aminopropyl)-2,3,5,6-tetrachlorophenyl]propan-2-amine |
|---|---|
| PubChem CID | 170864520 |
| Molecular Formula | C12H16Cl4N2 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 1-[4-(2-aminopropyl)-2,3,5,6-tetrachlorophenyl]propan-2-amine |
| SMILES | CC(N)Cc1c(Cl)c(Cl)c(CC(C)N)c(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl4N2/c1-5(17)3-7-9(13)11(15)8(4-6(2)18)12(16)10(7)14/h5-6H,3-4,17-18H2,1-2H3 |
| InChIKey | MLEBRXGBMULKSR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|