C9H9ClF3N — CID 117320924
1-(3-chloro-2,4,6-trifluorophenyl)propan-2-amine (PubChem CID 117320924) has the molecular formula C9H9ClF3N and a molecular weight of 223.63 g/mol. Its IUPAC name is 1-(3-chloro-2,4,6-trifluorophenyl)propan-2-amine.
| Compound Name | 1-(3-chloro-2,4,6-trifluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 117320924 |
| Molecular Formula | C9H9ClF3N |
| Molecular Weight | 223.63 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1-(3-chloro-2,4,6-trifluorophenyl)propan-2-amine |
| SMILES | CC(N)Cc1c(F)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H9ClF3N/c1-4(14)2-5-6(11)3-7(12)8(10)9(5)13/h3-4H,2,14H2,1H3 |
| InChIKey | ALBAPCXAPZTTJY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.63 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|