C9H8ClF3O — CID 117322509
3-(3-chloro-2,4,6-trifluorophenyl)propan-1-ol (PubChem CID 117322509) has the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. Its IUPAC name is 3-(3-chloro-2,4,6-trifluorophenyl)propan-1-ol.
| Compound Name | 3-(3-chloro-2,4,6-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 117322509 |
| Molecular Formula | C9H8ClF3O |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3-(3-chloro-2,4,6-trifluorophenyl)propan-1-ol |
| SMILES | OCCCc1c(F)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C9H8ClF3O/c10-8-7(12)4-6(11)5(9(8)13)2-1-3-14/h4,14H,1-3H2 |
| InChIKey | LXPQWLUQXTWQED-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|