C9H10BrFO3 — CID 117416400
3-bromo-5-fluoro-4-(3-hydroxypropyl)benzene-1,2-diol (PubChem CID 117416400) has the molecular formula C9H10BrFO3 and a molecular weight of 265.08 g/mol. Its IUPAC name is 3-bromo-5-fluoro-4-(3-hydroxypropyl)benzene-1,2-diol.
| Compound Name | 3-bromo-5-fluoro-4-(3-hydroxypropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117416400 |
| Molecular Formula | C9H10BrFO3 |
| Molecular Weight | 265.08 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 3-bromo-5-fluoro-4-(3-hydroxypropyl)benzene-1,2-diol |
| SMILES | OCCCc1c(F)cc(O)c(O)c1Br |
| InChI | InChI=1S/C9H10BrFO3/c10-8-5(2-1-3-12)6(11)4-7(13)9(8)14/h4,12-14H,1-3H2 |
| InChIKey | OJTMFNJCBUPASK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|