C8H8Br2O3 — CID 11500585
3,4-dibromo-5-(2-hydroxyethyl)benzene-1,2-diol (PubChem CID 11500585) has the molecular formula C8H8Br2O3 and a molecular weight of 311.96 g/mol. Its IUPAC name is 3,4-dibromo-5-(2-hydroxyethyl)benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-(2-hydroxyethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 11500585 |
| Molecular Formula | C8H8Br2O3 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | 3,4-dibromo-5-(2-hydroxyethyl)benzene-1,2-diol |
| SMILES | OCCc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C8H8Br2O3/c9-6-4(1-2-11)3-5(12)8(13)7(6)10/h3,11-13H,1-2H2 |
| InChIKey | HVSZPOZWYPXFAP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|