C8H11NO4 — CID 71395914
5-(2-aminoethyl)benzene-1,2,3,4-tetrol (PubChem CID 71395914) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-(2-aminoethyl)benzene-1,2,3,4-tetrol.
| Compound Name | 5-(2-aminoethyl)benzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 71395914 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 5-(2-aminoethyl)benzene-1,2,3,4-tetrol |
| SMILES | NCCc1cc(O)c(O)c(O)c1O |
| InChI | InChI=1S/C8H11NO4/c9-2-1-4-3-5(10)7(12)8(13)6(4)11/h3,10-13H,1-2,9H2 |
| InChIKey | SXZFCJURIWPUCO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|