C8H10O5 — CID 174601355
benzene-1,2,3,4,5-pentol;ethene (PubChem CID 174601355) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is benzene-1,2,3,4,5-pentol;ethene.
| Compound Name | benzene-1,2,3,4,5-pentol;ethene |
|---|---|
| PubChem CID | 174601355 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | benzene-1,2,3,4,5-pentol;ethene |
| SMILES | C=C.Oc1cc(O)c(O)c(O)c1O |
| InChI | InChI=1S/C6H6O5.C2H4/c7-2-1-3(8)5(10)6(11)4(2)9;1-2/h1,7-11H;1-2H2 |
| InChIKey | SJWLNLBHDIKNAQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|