C12H11O8P — CID 170224587
3-phosphanyl-6-(2,3,4,5-tetrahydroxyphenyl)benzene-1,2,4,5-tetrol (PubChem CID 170224587) has the molecular formula C12H11O8P and a molecular weight of 314.19 g/mol. Its IUPAC name is 3-phosphanyl-6-(2,3,4,5-tetrahydroxyphenyl)benzene-1,2,4,5-tetrol.
| Compound Name | 3-phosphanyl-6-(2,3,4,5-tetrahydroxyphenyl)benzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 170224587 |
| Molecular Formula | C12H11O8P |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3-phosphanyl-6-(2,3,4,5-tetrahydroxyphenyl)benzene-1,2,4,5-tetrol |
| SMILES | Oc1cc(-c2c(O)c(O)c(P)c(O)c2O)c(O)c(O)c1O |
| InChI | InChI=1S/C12H11O8P/c13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17/h1,13-20H,21H2 |
| InChIKey | XJZKAXUOBLRCKU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|