C20H24O8 — CID 162169030
2-methyl-1-(3,4,5-trihydroxyphenyl)propan-1-one (PubChem CID 162169030) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is 2-methyl-1-(3,4,5-trihydroxyphenyl)propan-1-one.
| Compound Name | 2-methyl-1-(3,4,5-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 162169030 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-methyl-1-(3,4,5-trihydroxyphenyl)propan-1-one |
| SMILES | CC(C)C(=O)c1cc(O)c(O)c(O)c1.CC(C)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/2C10H12O4/c2*1-5(2)9(13)6-3-7(11)10(14)8(12)4-6/h2*3-5,11-12,14H,1-2H3 |
| InChIKey | ZNNLPMHVVSWXLT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|