C12H16O4 — CID 166714506
2-methyl-1-(3,4,5-trihydroxyphenyl)pentan-1-one (PubChem CID 166714506) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-methyl-1-(3,4,5-trihydroxyphenyl)pentan-1-one.
| Compound Name | 2-methyl-1-(3,4,5-trihydroxyphenyl)pentan-1-one |
|---|---|
| PubChem CID | 166714506 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-methyl-1-(3,4,5-trihydroxyphenyl)pentan-1-one |
| SMILES | CCCC(C)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C12H16O4/c1-3-4-7(2)11(15)8-5-9(13)12(16)10(14)6-8/h5-7,13-14,16H,3-4H2,1-2H3 |
| InChIKey | GEBKWMBWCYTCIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|