C8H7N3O3 — CID 139672198
1-amino-3-iminoisoindole-4,5,6-triol (PubChem CID 139672198) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 1-amino-3-iminoisoindole-4,5,6-triol.
| Compound Name | 1-amino-3-iminoisoindole-4,5,6-triol |
|---|---|
| PubChem CID | 139672198 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 1-amino-3-iminoisoindole-4,5,6-triol |
| SMILES | [H]/N=C1\N=C(N)c2cc(O)c(O)c(O)c21 |
| InChI | InChI=1S/C8H7N3O3/c9-7-2-1-3(12)5(13)6(14)4(2)8(10)11-7/h1,12-14H,(H3,9,10,11) |
| InChIKey | DZNYHGHAJVYSOX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|