About chloro acetate;3-iminoisoindol-1-amine
chloro acetate;3-iminoisoindol-1-amine (PubChem CID 174364510) has the molecular formula C10H10ClN3O2
and a molecular weight of 239.66 g/mol. Its IUPAC name is chloro acetate;3-iminoisoindol-1-amine.
Molecular Properties
| Compound Name | chloro acetate;3-iminoisoindol-1-amine |
| PubChem CID | 174364510 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | chloro acetate;3-iminoisoindol-1-amine |
| SMILES | CC(=O)OCl.[H]/N=C1\N=C(N)c2ccccc21 |
| InChI | InChI=1S/C8H7N3.C2H3ClO2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2(4)5-3/h1-4H,(H3,9,10,11);1H3 |
| InChIKey | SRSGZCGMXKDNOD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze chloro acetate;3-iminoisoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro acetate;3-iminoisoindol-1-amine?
The IUPAC name of chloro acetate;3-iminoisoindol-1-amine (CID 174364510) is chloro acetate;3-iminoisoindol-1-amine.
What is the SMILES notation for chloro acetate;3-iminoisoindol-1-amine?
The canonical SMILES for chloro acetate;3-iminoisoindol-1-amine is CC(=O)OCl.[H]/N=C1\N=C(N)c2ccccc21.
What is the InChIKey of chloro acetate;3-iminoisoindol-1-amine?
The InChIKey is SRSGZCGMXKDNOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C2H3ClO2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2(4)5-3/h1-4H,(H3,9,10,11);1H3.
What are the key properties of chloro acetate;3-iminoisoindol-1-amine?
chloro acetate;3-iminoisoindol-1-amine has a molecular weight of 239.66 g/mol, XLogP of 1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro acetate;3-iminoisoindol-1-amine is sourced from PubChem (CID 174364510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).