About 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine
4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine (PubChem CID 70196856) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine.
Molecular Properties
| Compound Name | 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine |
| PubChem CID | 70196856 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine |
| SMILES | CCOC(=O)CCC(=O)O.[H]/N=C1\N=C(N)c2ccccc21 |
| InChI | InChI=1S/C8H7N3.C6H10O4/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-10-6(9)4-3-5(7)8/h1-4H,(H3,9,10,11);2-4H2,1H3,(H,7,8) |
| InChIKey | ABPHACGZDRLRJQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine?
The IUPAC name of 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine (CID 70196856) is 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine.
What is the SMILES notation for 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine?
The canonical SMILES for 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine is CCOC(=O)CCC(=O)O.[H]/N=C1\N=C(N)c2ccccc21.
What is the InChIKey of 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine?
The InChIKey is ABPHACGZDRLRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C6H10O4/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-10-6(9)4-3-5(7)8/h1-4H,(H3,9,10,11);2-4H2,1H3,(H,7,8).
What are the key properties of 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine?
4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine has a molecular weight of 291.31 g/mol, XLogP of 1.15, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-4-oxobutanoic acid;3-iminoisoindol-1-amine is sourced from PubChem (CID 70196856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).