About benzene;4-ethoxy-4-oxobutanoic acid
benzene;4-ethoxy-4-oxobutanoic acid (PubChem CID 67333370) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is benzene;4-ethoxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | benzene;4-ethoxy-4-oxobutanoic acid |
| PubChem CID | 67333370 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | benzene;4-ethoxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)CCC(=O)O.c1ccccc1 |
| InChI | InChI=1S/C6H10O4.C6H6/c1-2-10-6(9)4-3-5(7)8;1-2-4-6-5-3-1/h2-4H2,1H3,(H,7,8);1-6H |
| InChIKey | GZRUZMUMUSVHQO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;4-ethoxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-ethoxy-4-oxobutanoic acid?
The IUPAC name of benzene;4-ethoxy-4-oxobutanoic acid (CID 67333370) is benzene;4-ethoxy-4-oxobutanoic acid.
What is the SMILES notation for benzene;4-ethoxy-4-oxobutanoic acid?
The canonical SMILES for benzene;4-ethoxy-4-oxobutanoic acid is CCOC(=O)CCC(=O)O.c1ccccc1.
What is the InChIKey of benzene;4-ethoxy-4-oxobutanoic acid?
The InChIKey is GZRUZMUMUSVHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C6H6/c1-2-10-6(9)4-3-5(7)8;1-2-4-6-5-3-1/h2-4H2,1H3,(H,7,8);1-6H.
What are the key properties of benzene;4-ethoxy-4-oxobutanoic acid?
benzene;4-ethoxy-4-oxobutanoic acid has a molecular weight of 224.26 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-ethoxy-4-oxobutanoic acid is sourced from PubChem (CID 67333370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).