C15H15NO5 — CID 103484663
ethyl 5-(2,3-dioxoindol-1-yl)-4-oxopentanoate (PubChem CID 103484663) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is ethyl 5-(2,3-dioxoindol-1-yl)-4-oxopentanoate.
| Compound Name | ethyl 5-(2,3-dioxoindol-1-yl)-4-oxopentanoate |
|---|---|
| PubChem CID | 103484663 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl 5-(2,3-dioxoindol-1-yl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H15NO5/c1-2-21-13(18)8-7-10(17)9-16-12-6-4-3-5-11(12)14(19)15(16)20/h3-6H,2,7-9H2,1H3 |
| InChIKey | VYHPGUZFRASPSY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|