C13H10N2O4 — CID 7804446
[(1R)-1-cyanoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804446) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(1R)-1-cyanoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804446 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | C[C@H](C#N)OC(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H10N2O4/c1-8(6-14)19-11(16)7-15-10-5-3-2-4-9(10)12(17)13(15)18/h2-5,8H,7H2,1H3/t8-/m1/s1 |
| InChIKey | RQIBLSWWGSWMLU-MRVPVSSYSA-N |
| XLogP | 0.67 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|