C13H12N2O3S — CID 8673715
[(1R)-1-cyanoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate (PubChem CID 8673715) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate.
| Compound Name | [(1R)-1-cyanoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 8673715 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(3-oxo-1,4-benzothiazin-4-yl)acetate |
| SMILES | C[C@H](C#N)OC(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C13H12N2O3S/c1-9(6-14)18-13(17)7-15-10-4-2-3-5-11(10)19-8-12(15)16/h2-5,9H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | WBWBOFGPRBOSSQ-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |