C21H17N3O5 — CID 8603326
[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8603326) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 8603326 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | Cc1ccc(-c2nnc([C@@H](C)OC(=O)CN3C(=O)C(=O)c4ccccc43)o2)cc1 |
| InChI | InChI=1S/C21H17N3O5/c1-12-7-9-14(10-8-12)20-23-22-19(29-20)13(2)28-17(25)11-24-16-6-4-3-5-15(16)18(26)21(24)27/h3-10,13H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | JEIDLQBEBOVCHL-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|