C27H21N3O5 — CID 46543531
1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 46543531) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 46543531 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | Cc1ccc(-c2nnc(C(C)OC(=O)c3ccc(CN4C(=O)c5ccccc5C4=O)cc3)o2)cc1 |
| InChI | InChI=1S/C27H21N3O5/c1-16-7-11-19(12-8-16)24-29-28-23(35-24)17(2)34-27(33)20-13-9-18(10-14-20)15-30-25(31)21-5-3-4-6-22(21)26(30)32/h3-14,17H,15H2,1-2H3 |
| InChIKey | UQQNPKWFOATQJN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|