C15H18N2O3 — CID 60630184
2-(2,3-dioxoindol-1-yl)-N-(3-methylbutan-2-yl)acetamide (PubChem CID 60630184) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(2,3-dioxoindol-1-yl)-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(2,3-dioxoindol-1-yl)-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 60630184 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(2,3-dioxoindol-1-yl)-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(C)NC(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H18N2O3/c1-9(2)10(3)16-13(18)8-17-12-7-5-4-6-11(12)14(19)15(17)20/h4-7,9-10H,8H2,1-3H3,(H,16,18) |
| InChIKey | PXMIJVZGSJQCIC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|