C14H16N2O4 — CID 61355137
2-(5-methoxy-2,3-dioxoindol-1-yl)-N-propan-2-ylacetamide (PubChem CID 61355137) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dioxoindol-1-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(5-methoxy-2,3-dioxoindol-1-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 61355137 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(5-methoxy-2,3-dioxoindol-1-yl)-N-propan-2-ylacetamide |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2CC(=O)NC(C)C |
| InChI | InChI=1S/C14H16N2O4/c1-8(2)15-12(17)7-16-11-5-4-9(20-3)6-10(11)13(18)14(16)19/h4-6,8H,7H2,1-3H3,(H,15,17) |
| InChIKey | CNKVXYZYEJQGNQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|