C14H13N3O4 — CID 61355949
N-(2-cyanoethyl)-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61355949) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61355949 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(2-cyanoethyl)-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)N2CC(=O)NCCC#N |
| InChI | InChI=1S/C14H13N3O4/c1-21-9-3-4-11-10(7-9)13(19)14(20)17(11)8-12(18)16-6-2-5-15/h3-4,7H,2,6,8H2,1H3,(H,16,18) |
| InChIKey | CUIKPQWBULGIDY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|