C15H18N2O4 — CID 61485568
N-butyl-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61485568) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-butyl-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-butyl-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61485568 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-butyl-2-(5-methoxy-2,3-dioxoindol-1-yl)acetamide |
| SMILES | CCCCNC(=O)CN1C(=O)C(=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C15H18N2O4/c1-3-4-7-16-13(18)9-17-12-6-5-10(21-2)8-11(12)14(19)15(17)20/h5-6,8H,3-4,7,9H2,1-2H3,(H,16,18) |
| InChIKey | CYMPNAXECQYJRT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|