C14H15BrN2O3 — CID 61485417
2-(5-bromo-2,3-dioxoindol-1-yl)-N-butylacetamide (PubChem CID 61485417) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 2-(5-bromo-2,3-dioxoindol-1-yl)-N-butylacetamide.
| Compound Name | 2-(5-bromo-2,3-dioxoindol-1-yl)-N-butylacetamide |
|---|---|
| PubChem CID | 61485417 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-(5-bromo-2,3-dioxoindol-1-yl)-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1C(=O)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H15BrN2O3/c1-2-3-6-16-12(18)8-17-11-5-4-9(15)7-10(11)13(19)14(17)20/h4-5,7H,2-3,6,8H2,1H3,(H,16,18) |
| InChIKey | WZPQGLZVJKDXMQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|