C21H16Br2N2O4 — CID 139227607
5-bromo-1-[5-(5-bromo-2,3-dioxoindol-1-yl)pentyl]indole-2,3-dione (PubChem CID 139227607) has the molecular formula C21H16Br2N2O4 and a molecular weight of 520.18 g/mol. Its IUPAC name is 5-bromo-1-[5-(5-bromo-2,3-dioxoindol-1-yl)pentyl]indole-2,3-dione.
| Compound Name | 5-bromo-1-[5-(5-bromo-2,3-dioxoindol-1-yl)pentyl]indole-2,3-dione |
|---|---|
| PubChem CID | 139227607 |
| Molecular Formula | C21H16Br2N2O4 |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | 5-bromo-1-[5-(5-bromo-2,3-dioxoindol-1-yl)pentyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCCN2C(=O)C(=O)c3cc(Br)ccc32)c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H16Br2N2O4/c22-12-4-6-16-14(10-12)18(26)20(28)24(16)8-2-1-3-9-25-17-7-5-13(23)11-15(17)19(27)21(25)29/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | PGJGDBRAPHGBEI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|