C12H10BrNO4 — CID 18072187
4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid (PubChem CID 18072187) has the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. Its IUPAC name is 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid.
| Compound Name | 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 18072187 |
| Molecular Formula | C12H10BrNO4 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C12H10BrNO4/c13-7-3-4-8-9(6-7)14(12(18)11(8)17)5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,15,16) |
| InChIKey | FBFNBGCTLQWELS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|