4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid

C12H10BrNO4 — CID 18072187

IUPAC4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid
SMILESO=C(O)CCCN1C(=O)C(=O)c2ccc(Br)cc21
InChIInChI=1S/C12H10BrNO4/c13-7-3-4-8-9(6-7)14(12(18)11(8)17)5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,15,16)
InChIKeyFBFNBGCTLQWELS-UHFFFAOYSA-N
MW312.12 g/mol
LogP1.84
Rot. Bonds4

About 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid

4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid (PubChem CID 18072187) has the molecular formula C12H10BrNO4 and a molecular weight of 312.12 g/mol. Its IUPAC name is 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid.

Molecular Properties

Compound Name4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid
PubChem CID18072187
Molecular FormulaC12H10BrNO4
Molecular Weight312.12 g/mol
Exact Mass310.98
IUPAC Name4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid
SMILESO=C(O)CCCN1C(=O)C(=O)c2ccc(Br)cc21
InChIInChI=1S/C12H10BrNO4/c13-7-3-4-8-9(6-7)14(12(18)11(8)17)5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,15,16)
InChIKeyFBFNBGCTLQWELS-UHFFFAOYSA-N
XLogP1.84
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.12
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid?
The IUPAC name of 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid (CID 18072187) is 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid.
What is the SMILES notation for 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid?
The canonical SMILES for 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid is O=C(O)CCCN1C(=O)C(=O)c2ccc(Br)cc21.
What is the InChIKey of 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid?
The InChIKey is FBFNBGCTLQWELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO4/c13-7-3-4-8-9(6-7)14(12(18)11(8)17)5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,15,16).
What are the key properties of 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid?
4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid has a molecular weight of 312.12 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromo-2,3-dioxoindol-1-yl)butanoic acid is sourced from PubChem (CID 18072187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).