C15H15BrN2O3 — CID 29299798
2-(6-bromo-2,3-dioxoindol-1-yl)-N-cyclopentylacetamide (PubChem CID 29299798) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-(6-bromo-2,3-dioxoindol-1-yl)-N-cyclopentylacetamide.
| Compound Name | 2-(6-bromo-2,3-dioxoindol-1-yl)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 29299798 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-(6-bromo-2,3-dioxoindol-1-yl)-N-cyclopentylacetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2ccc(Br)cc21)NC1CCCC1 |
| InChI | InChI=1S/C15H15BrN2O3/c16-9-5-6-11-12(7-9)18(15(21)14(11)20)8-13(19)17-10-3-1-2-4-10/h5-7,10H,1-4,8H2,(H,17,19) |
| InChIKey | LACMSRXGHGIZLA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|