C16H19BrN2O2 — CID 107912778
6-bromo-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione (PubChem CID 107912778) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 6-bromo-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione.
| Compound Name | 6-bromo-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 107912778 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 6-bromo-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione |
| SMILES | CN1CCCCC1CCN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H19BrN2O2/c1-18-8-3-2-4-12(18)7-9-19-14-10-11(17)5-6-13(14)15(20)16(19)21/h5-6,10,12H,2-4,7-9H2,1H3 |
| InChIKey | SMOYNDLSURTHCS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|