C17H22N2O2 — CID 107912779
7-methyl-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione (PubChem CID 107912779) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 7-methyl-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione.
| Compound Name | 7-methyl-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 107912779 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 7-methyl-1-[2-(1-methylpiperidin-2-yl)ethyl]indole-2,3-dione |
| SMILES | Cc1cccc2c1N(CCC1CCCCN1C)C(=O)C2=O |
| InChI | InChI=1S/C17H22N2O2/c1-12-6-5-8-14-15(12)19(17(21)16(14)20)11-9-13-7-3-4-10-18(13)2/h5-6,8,13H,3-4,7,9-11H2,1-2H3 |
| InChIKey | HVRIOBRBKDLWET-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|