C14H16BrNO4S — CID 106726046
6-bromo-1-(2-tert-butylsulfonylethyl)indole-2,3-dione (PubChem CID 106726046) has the molecular formula C14H16BrNO4S and a molecular weight of 374.26 g/mol. Its IUPAC name is 6-bromo-1-(2-tert-butylsulfonylethyl)indole-2,3-dione.
| Compound Name | 6-bromo-1-(2-tert-butylsulfonylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 106726046 |
| Molecular Formula | C14H16BrNO4S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 6-bromo-1-(2-tert-butylsulfonylethyl)indole-2,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)CCN1C(=O)C(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C14H16BrNO4S/c1-14(2,3)21(19,20)7-6-16-11-8-9(15)4-5-10(11)12(17)13(16)18/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | ZJDCLFYMVMUYJK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|