C15H15BrN2O2 — CID 65255661
5-(5-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 65255661) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 5-(5-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(5-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255661 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5-(5-bromo-2,3-dioxoindol-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN1C(=O)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H15BrN2O2/c1-15(2,9-17)6-3-7-18-12-5-4-10(16)8-11(12)13(19)14(18)20/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | WMXWSLZOSCAQHI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|