C14H12ClFN2O2 — CID 79336431
4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile (PubChem CID 79336431) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 79336431 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-(5-chloro-6-fluoro-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCN1C(=O)C(=O)c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C14H12ClFN2O2/c1-14(2,7-17)3-4-18-11-6-10(16)9(15)5-8(11)12(19)13(18)20/h5-6H,3-4H2,1-2H3 |
| InChIKey | DQRTXZAKKKKIII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|