C13H9ClFN3O2 — CID 79336013
5-chloro-6-fluoro-1-[(1-methylimidazol-2-yl)methyl]indole-2,3-dione (PubChem CID 79336013) has the molecular formula C13H9ClFN3O2 and a molecular weight of 293.69 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-[(1-methylimidazol-2-yl)methyl]indole-2,3-dione.
| Compound Name | 5-chloro-6-fluoro-1-[(1-methylimidazol-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 79336013 |
| Molecular Formula | C13H9ClFN3O2 |
| Molecular Weight | 293.69 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-chloro-6-fluoro-1-[(1-methylimidazol-2-yl)methyl]indole-2,3-dione |
| SMILES | Cn1ccnc1CN1C(=O)C(=O)c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C13H9ClFN3O2/c1-17-3-2-16-11(17)6-18-10-5-9(15)8(14)4-7(10)12(19)13(18)20/h2-5H,6H2,1H3 |
| InChIKey | LRXQWAIMKKYRIL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|