C16H18N2O2 — CID 65253716
4-(5,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile (PubChem CID 65253716) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(5,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(5,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65253716 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(5,7-dimethyl-2,3-dioxoindol-1-yl)-2,2-dimethylbutanenitrile |
| SMILES | Cc1cc(C)c2c(c1)C(=O)C(=O)N2CCC(C)(C)C#N |
| InChI | InChI=1S/C16H18N2O2/c1-10-7-11(2)13-12(8-10)14(19)15(20)18(13)6-5-16(3,4)9-17/h7-8H,5-6H2,1-4H3 |
| InChIKey | NTAPMGQWWIBGPX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|